C23H29N3O6 — CID 93110023
N-butyl-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 93110023) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-butyl-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-butyl-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 93110023 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-butyl-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CCCCN(CC(=O)N(Cc1ccco1)C[C@H]1CCCO1)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H29N3O6/c1-2-3-12-24(23(28)18-8-10-19(11-9-18)26(29)30)17-22(27)25(15-20-6-4-13-31-20)16-21-7-5-14-32-21/h4,6,8-11,13,21H,2-3,5,7,12,14-17H2,1H3/t21-/m1/s1 |
| InChIKey | GECASIOPAGNCJY-OAQYLSRUSA-N |
| XLogP | 3.64 |
| TPSA | 106.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|