C19H30N2O5 — CID 5145346
2-[butyl-(2-methoxyacetyl)amino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 5145346) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-[butyl-(2-methoxyacetyl)amino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[butyl-(2-methoxyacetyl)amino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5145346 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[butyl-(2-methoxyacetyl)amino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CCCCN(CC(=O)N(Cc1ccco1)CC1CCCO1)C(=O)COC |
| InChI | InChI=1S/C19H30N2O5/c1-3-4-9-20(19(23)15-24-2)14-18(22)21(12-16-7-5-10-25-16)13-17-8-6-11-26-17/h5,7,10,17H,3-4,6,8-9,11-15H2,1-2H3 |
| InChIKey | RYOUQPJYNWFHKY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |