C22H36N2O4 — CID 7237047
N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-N-propan-2-ylheptanamide (PubChem CID 7237047) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-N-propan-2-ylheptanamide.
| Compound Name | N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-N-propan-2-ylheptanamide |
|---|---|
| PubChem CID | 7237047 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-N-propan-2-ylheptanamide |
| SMILES | CCCCCCC(=O)N(CC(=O)N(Cc1ccco1)C[C@@H]1CCCO1)C(C)C |
| InChI | InChI=1S/C22H36N2O4/c1-4-5-6-7-12-21(25)24(18(2)3)17-22(26)23(15-19-10-8-13-27-19)16-20-11-9-14-28-20/h8,10,13,18,20H,4-7,9,11-12,14-17H2,1-3H3/t20-/m0/s1 |
| InChIKey | HUAPGVYOYKOPMY-FQEVSTJZSA-N |
| XLogP | 3.99 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|