C21H34N2O4 — CID 93110010
N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]pentanamide (PubChem CID 93110010) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]pentanamide.
| Compound Name | N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 93110010 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]pentanamide |
| SMILES | CCCCC(=O)N(CCCC)CC(=O)N(Cc1ccco1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H34N2O4/c1-3-5-11-20(24)22(12-6-4-2)17-21(25)23(15-18-9-7-13-26-18)16-19-10-8-14-27-19/h7,9,13,19H,3-6,8,10-12,14-17H2,1-2H3/t19-/m0/s1 |
| InChIKey | BLBQXEYDACZYRF-IBGZPJMESA-N |
| XLogP | 3.61 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |