C22H36N2O4 — CID 93110032
N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]hexanamide (PubChem CID 93110032) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]hexanamide.
| Compound Name | N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 93110032 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N-butyl-N-[2-[furan-2-ylmethyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCCC)CC(=O)N(Cc1ccco1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H36N2O4/c1-3-5-7-12-21(25)23(13-6-4-2)18-22(26)24(16-19-10-8-14-27-19)17-20-11-9-15-28-20/h8,10,14,20H,3-7,9,11-13,15-18H2,1-2H3/t20-/m0/s1 |
| InChIKey | YJWOMXWSXWXWKH-FQEVSTJZSA-N |
| XLogP | 4.00 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|