C28H39FN2O4 — CID 98396498
N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]nonanamide (PubChem CID 98396498) has the molecular formula C28H39FN2O4 and a molecular weight of 486.63 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]nonanamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]nonanamide |
|---|---|
| PubChem CID | 98396498 |
| Molecular Formula | C28H39FN2O4 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CC(=O)N(Cc1ccc(F)cc1)Cc1ccco1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C28H39FN2O4/c1-2-3-4-5-6-7-12-27(32)31(21-26-11-9-18-35-26)22-28(33)30(20-25-10-8-17-34-25)19-23-13-15-24(29)16-14-23/h8,10,13-17,26H,2-7,9,11-12,18-22H2,1H3/t26-/m0/s1 |
| InChIKey | ZBHZRFZUBXOWIS-SANMLTNESA-N |
| XLogP | 5.71 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|