C17H26N2O4 — CID 7271437
2-[acetyl(propyl)amino]-N-(furan-2-ylmethyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 7271437) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[acetyl(propyl)amino]-N-(furan-2-ylmethyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[acetyl(propyl)amino]-N-(furan-2-ylmethyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 7271437 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-[acetyl(propyl)amino]-N-(furan-2-ylmethyl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | CCCN(CC(=O)N(Cc1ccco1)C[C@H]1CCCO1)C(C)=O |
| InChI | InChI=1S/C17H26N2O4/c1-3-8-18(14(2)20)13-17(21)19(11-15-6-4-9-22-15)12-16-7-5-10-23-16/h4,6,9,16H,3,5,7-8,10-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | JSFUIBWKLRFPMW-MRXNPFEDSA-N |
| XLogP | 2.05 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |