C17H17N3O7 — CID 42664603
N-(furan-2-ylmethyl)-3,5-dinitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 42664603) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,5-dinitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3,5-dinitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42664603 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,5-dinitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C17H17N3O7/c21-17(12-7-13(19(22)23)9-14(8-12)20(24)25)18(10-15-3-1-5-26-15)11-16-4-2-6-27-16/h1,3,5,7-9,16H,2,4,6,10-11H2 |
| InChIKey | BXEFEZDWEXKOOD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 128.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|