C17H17Cl2NO3 — CID 3361350
2,4-dichloro-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3361350) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 2,4-dichloro-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3361350 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2,4-dichloro-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N(Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C17H17Cl2NO3/c18-12-5-6-15(16(19)9-12)17(21)20(10-13-3-1-7-22-13)11-14-4-2-8-23-14/h1,3,5-7,9,14H,2,4,8,10-11H2 |
| InChIKey | VFFCCLNMNSSIHS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |