C18H21N3O5 — CID 60577323
1-(furan-2-ylmethyl)-3-(4-methyl-3-nitrophenyl)-1-(oxolan-2-ylmethyl)urea (PubChem CID 60577323) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(4-methyl-3-nitrophenyl)-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(4-methyl-3-nitrophenyl)-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60577323 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(4-methyl-3-nitrophenyl)-1-(oxolan-2-ylmethyl)urea |
| SMILES | Cc1ccc(NC(=O)N(Cc2ccco2)CC2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N3O5/c1-13-6-7-14(10-17(13)21(23)24)19-18(22)20(11-15-4-2-8-25-15)12-16-5-3-9-26-16/h2,4,6-8,10,16H,3,5,9,11-12H2,1H3,(H,19,22) |
| InChIKey | XMNXXUSSLUCRRM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|