C18H21ClN2O2S — CID 47510909
3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 47510909) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 47510909 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccco2)CC2CCCO2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O2S/c1-13-6-7-14(10-17(13)19)20-18(24)21(11-15-4-2-8-22-15)12-16-5-3-9-23-16/h2,4,6-8,10,16H,3,5,9,11-12H2,1H3,(H,20,24) |
| InChIKey | TYMUFWYDINDWPM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|