C19H24N2O2S — CID 47510906
3-(2,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 47510906) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(2,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 47510906 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N(Cc2ccco2)CC2CCCO2)c1 |
| InChI | InChI=1S/C19H24N2O2S/c1-14-7-8-15(2)18(11-14)20-19(24)21(12-16-5-3-9-22-16)13-17-6-4-10-23-17/h3,5,7-9,11,17H,4,6,10,12-13H2,1-2H3,(H,20,24) |
| InChIKey | JWPHFOZZTKNLHE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|