C21H25FN2O2S — CID 4163551
1-[(4-fluorophenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 4163551) has the molecular formula C21H25FN2O2S and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4163551 |
| Molecular Formula | C21H25FN2O2S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)N(Cc1ccc(F)cc1)CC1CCCO1 |
| InChI | InChI=1S/C21H25FN2O2S/c1-15-5-10-20(25-2)19(12-15)23-21(27)24(14-18-4-3-11-26-18)13-16-6-8-17(22)9-7-16/h5-10,12,18H,3-4,11,13-14H2,1-2H3,(H,23,27) |
| InChIKey | SAKZDXQINVTPAV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|