C24H32N2O5S — CID 4053042
3-(2-ethoxyphenyl)-1-(oxolan-2-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 4053042) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-1-(oxolan-2-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 3-(2-ethoxyphenyl)-1-(oxolan-2-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4053042 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 3-(2-ethoxyphenyl)-1-(oxolan-2-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | CCOc1ccccc1NC(=S)N(Cc1cc(OC)c(OC)c(OC)c1)CC1CCCO1 |
| InChI | InChI=1S/C24H32N2O5S/c1-5-30-20-11-7-6-10-19(20)25-24(32)26(16-18-9-8-12-31-18)15-17-13-21(27-2)23(29-4)22(14-17)28-3/h6-7,10-11,13-14,18H,5,8-9,12,15-16H2,1-4H3,(H,25,32) |
| InChIKey | NVCWMVBWRTYRES-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|