C20H30N2O4 — CID 51952595
2-[bis[[(2S)-oxolan-2-yl]methyl]amino]-N-(2-ethoxyphenyl)acetamide (PubChem CID 51952595) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[bis[[(2S)-oxolan-2-yl]methyl]amino]-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-[bis[[(2S)-oxolan-2-yl]methyl]amino]-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51952595 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[bis[[(2S)-oxolan-2-yl]methyl]amino]-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN(C[C@@H]1CCCO1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H30N2O4/c1-2-24-19-10-4-3-9-18(19)21-20(23)15-22(13-16-7-5-11-25-16)14-17-8-6-12-26-17/h3-4,9-10,16-17H,2,5-8,11-15H2,1H3,(H,21,23)/t16-,17-/m0/s1 |
| InChIKey | GDJAMGPVIBONEW-IRXDYDNUSA-N |
| XLogP | 2.68 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |