C23H30N2O4S — CID 4613982
1-[(2,3-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 4613982) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4613982 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl]-3-(4-ethoxyphenyl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2cccc(OC)c2OC)CC2CCCO2)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-4-28-19-12-10-18(11-13-19)24-23(30)25(16-20-8-6-14-29-20)15-17-7-5-9-21(26-2)22(17)27-3/h5,7,9-13,20H,4,6,8,14-16H2,1-3H3,(H,24,30) |
| InChIKey | VUPWQGMUUWLOAA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|