C21H25BrN2O3S — CID 4988126
3-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 4988126) has the molecular formula C21H25BrN2O3S and a molecular weight of 465.41 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4988126 |
| Molecular Formula | C21H25BrN2O3S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 3-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc(CN(CC2CCCO2)C(=S)Nc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H25BrN2O3S/c1-25-18-10-5-15(20(12-18)26-2)13-24(14-19-4-3-11-27-19)21(28)23-17-8-6-16(22)7-9-17/h5-10,12,19H,3-4,11,13-14H2,1-2H3,(H,23,28) |
| InChIKey | JEWXZRSLMYWEBI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|