C19H20ClF3N2O2S — CID 17375871
3-[3-chloro-4-(trifluoromethyl)phenyl]-1-[(5-methylfuran-2-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 17375871) has the molecular formula C19H20ClF3N2O2S and a molecular weight of 432.90 g/mol. Its IUPAC name is 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-[(5-methylfuran-2-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-[(5-methylfuran-2-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17375871 |
| Molecular Formula | C19H20ClF3N2O2S |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-[(5-methylfuran-2-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(CN(CC2CCCO2)C(=S)Nc2ccc(C(F)(F)F)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H20ClF3N2O2S/c1-12-4-6-15(27-12)11-25(10-14-3-2-8-26-14)18(28)24-13-5-7-16(17(20)9-13)19(21,22)23/h4-7,9,14H,2-3,8,10-11H2,1H3,(H,24,28) |
| InChIKey | GDOBOGGYWYDNBC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|