C18H18ClF3N2OS — CID 3284754
3-[3-chloro-4-(trifluoromethyl)phenyl]-1-cyclopentyl-1-(furan-2-ylmethyl)thiourea (PubChem CID 3284754) has the molecular formula C18H18ClF3N2OS and a molecular weight of 402.87 g/mol. Its IUPAC name is 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-cyclopentyl-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-cyclopentyl-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3284754 |
| Molecular Formula | C18H18ClF3N2OS |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-cyclopentyl-1-(furan-2-ylmethyl)thiourea |
| SMILES | FC(F)(F)c1ccc(NC(=S)N(Cc2ccco2)C2CCCC2)cc1Cl |
| InChI | InChI=1S/C18H18ClF3N2OS/c19-16-10-12(7-8-15(16)18(20,21)22)23-17(26)24(13-4-1-2-5-13)11-14-6-3-9-25-14/h3,6-10,13H,1-2,4-5,11H2,(H,23,26) |
| InChIKey | OYLRIBMMHQHTGO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|