C18H14ClF3N2OS2 — CID 44665633
3-[3-chloro-4-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 44665633) has the molecular formula C18H14ClF3N2OS2 and a molecular weight of 430.90 g/mol. Its IUPAC name is 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 44665633 |
| Molecular Formula | C18H14ClF3N2OS2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 3-[3-chloro-4-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | FC(F)(F)c1ccc(NC(=S)N(Cc2ccco2)Cc2cccs2)cc1Cl |
| InChI | InChI=1S/C18H14ClF3N2OS2/c19-16-9-12(5-6-15(16)18(20,21)22)23-17(26)24(10-13-3-1-7-25-13)11-14-4-2-8-27-14/h1-9H,10-11H2,(H,23,26) |
| InChIKey | KCJBIMPLXNKCFO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|