C19H17F3N2O2S — CID 90495819
1-(furan-2-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 90495819) has the molecular formula C19H17F3N2O2S and a molecular weight of 394.42 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90495819 |
| Molecular Formula | C19H17F3N2O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N(CCc1cccs1)Cc1ccco1 |
| InChI | InChI=1S/C19H17F3N2O2S/c20-19(21,22)14-5-7-15(8-6-14)23-18(25)24(13-16-3-1-11-26-16)10-9-17-4-2-12-27-17/h1-8,11-12H,9-10,13H2,(H,23,25) |
| InChIKey | VAWNJNXYMZLQCJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |