C20H19BrN2O2 — CID 1058618
3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-(2-phenylethyl)urea (PubChem CID 1058618) has the molecular formula C20H19BrN2O2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-(2-phenylethyl)urea.
| Compound Name | 3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 1058618 |
| Molecular Formula | C20H19BrN2O2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-(2-phenylethyl)urea |
| SMILES | O=C(Nc1ccc(Br)cc1)N(CCc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C20H19BrN2O2/c21-17-8-10-18(11-9-17)22-20(24)23(15-19-7-4-14-25-19)13-12-16-5-2-1-3-6-16/h1-11,14H,12-13,15H2,(H,22,24) |
| InChIKey | USKNWRUBFYLUPO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |