C27H31N3O3 — CID 5183118
2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide (PubChem CID 5183118) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 5183118 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C27H31N3O3/c1-4-15-30(27(32)28-24-13-12-21(2)22(3)18-24)20-26(31)29(19-25-11-8-17-33-25)16-14-23-9-6-5-7-10-23/h4-13,17-18H,1,14-16,19-20H2,2-3H3,(H,28,32) |
| InChIKey | KLMNTVQMPROKKM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|