C26H29N3O2S — CID 3466924
N-benzyl-2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3466924) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-benzyl-2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3466924 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-benzyl-2-[(3,4-dimethylphenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H29N3O2S/c1-4-14-28(26(31)27-23-13-12-20(2)21(3)16-23)19-25(30)29(18-24-11-8-15-32-24)17-22-9-6-5-7-10-22/h4-13,15-16H,1,14,17-19H2,2-3H3,(H,27,31) |
| InChIKey | RGCOMALRTIQGHU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|