C24H24FN3O2S — CID 4664024
N-benzyl-2-[(2-fluorophenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4664024) has the molecular formula C24H24FN3O2S and a molecular weight of 437.54 g/mol. Its IUPAC name is N-benzyl-2-[(2-fluorophenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[(2-fluorophenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4664024 |
| Molecular Formula | C24H24FN3O2S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-benzyl-2-[(2-fluorophenyl)carbamoyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C24H24FN3O2S/c1-2-14-27(24(30)26-22-13-7-6-12-21(22)25)18-23(29)28(17-20-11-8-15-31-20)16-19-9-4-3-5-10-19/h2-13,15H,1,14,16-18H2,(H,26,30) |
| InChIKey | QGNKNUUBOSRMRY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|