C24H23BrN2O2S — CID 3957992
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-bromo-N-prop-2-enylbenzamide (PubChem CID 3957992) has the molecular formula C24H23BrN2O2S and a molecular weight of 483.43 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-bromo-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-bromo-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 3957992 |
| Molecular Formula | C24H23BrN2O2S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-bromo-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H23BrN2O2S/c1-2-14-26(24(29)20-10-12-21(25)13-11-20)18-23(28)27(17-22-9-6-15-30-22)16-19-7-4-3-5-8-19/h2-13,15H,1,14,16-18H2 |
| InChIKey | SMEGHLAUPXBBML-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|