C28H34N2O2S — CID 3986046
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-butyl-N-propylbenzamide (PubChem CID 3986046) has the molecular formula C28H34N2O2S and a molecular weight of 462.66 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-butyl-N-propylbenzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-butyl-N-propylbenzamide |
|---|---|
| PubChem CID | 3986046 |
| Molecular Formula | C28H34N2O2S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-4-butyl-N-propylbenzamide |
| SMILES | CCCCc1ccc(C(=O)N(CCC)CC(=O)N(Cc2ccccc2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C28H34N2O2S/c1-3-5-10-23-14-16-25(17-15-23)28(32)29(18-4-2)22-27(31)30(21-26-13-9-19-33-26)20-24-11-7-6-8-12-24/h6-9,11-17,19H,3-5,10,18,20-22H2,1-2H3 |
| InChIKey | UIPSHTAYXWWPAH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |