C25H26ClN3O4S — CID 4689455
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butyl-4-chloro-3-nitrobenzamide (PubChem CID 4689455) has the molecular formula C25H26ClN3O4S and a molecular weight of 500.02 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butyl-4-chloro-3-nitrobenzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butyl-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 4689455 |
| Molecular Formula | C25H26ClN3O4S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butyl-4-chloro-3-nitrobenzamide |
| SMILES | CCCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26ClN3O4S/c1-2-3-13-27(25(31)20-11-12-22(26)23(15-20)29(32)33)18-24(30)28(17-21-10-7-14-34-21)16-19-8-5-4-6-9-19/h4-12,14-15H,2-3,13,16-18H2,1H3 |
| InChIKey | AHYSQSBLURWCEX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|