C26H29ClN2O3S — CID 5002484
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)benzamide (PubChem CID 5002484) has the molecular formula C26H29ClN2O3S and a molecular weight of 485.05 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)benzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 5002484 |
| Molecular Formula | C26H29ClN2O3S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H29ClN2O3S/c1-2-32-15-8-14-28(26(31)22-11-6-12-23(27)17-22)20-25(30)29(19-24-13-7-16-33-24)18-21-9-4-3-5-10-21/h3-7,9-13,16-17H,2,8,14-15,18-20H2,1H3 |
| InChIKey | LNAYZJLIDALMMN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|