C24H25FN2O3S — CID 3459642
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-fluoro-N-(2-methoxyethyl)benzamide (PubChem CID 3459642) has the molecular formula C24H25FN2O3S and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-fluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-fluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 3459642 |
| Molecular Formula | C24H25FN2O3S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-fluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C24H25FN2O3S/c1-30-13-12-26(24(29)20-9-5-10-21(25)15-20)18-23(28)27(17-22-11-6-14-31-22)16-19-7-3-2-4-8-19/h2-11,14-15H,12-13,16-18H2,1H3 |
| InChIKey | DZYSYLDUSFAALP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |