C26H29N3O4 — CID 3928097
N-benzyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 3928097) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-benzyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3928097 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-benzyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-3-16-28(26(31)27-22-12-14-23(15-13-22)32-4-2)20-25(30)29(19-24-11-8-17-33-24)18-21-9-6-5-7-10-21/h3,5-15,17H,1,4,16,18-20H2,2H3,(H,27,31) |
| InChIKey | QQAUZEYOSAQXMU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|