C22H26N2O3 — CID 4611642
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylcyclobutanecarboxamide (PubChem CID 4611642) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylcyclobutanecarboxamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 4611642 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-prop-2-enylcyclobutanecarboxamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)C1CCC1 |
| InChI | InChI=1S/C22H26N2O3/c1-2-13-23(22(26)19-10-6-11-19)17-21(25)24(16-20-12-7-14-27-20)15-18-8-4-3-5-9-18/h2-5,7-9,12,14,19H,1,6,10-11,13,15-17H2 |
| InChIKey | WPCWYVPJIPNULE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|