C23H28N2O4 — CID 3943750
N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide (PubChem CID 3943750) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide.
| Compound Name | N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 3943750 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccco1)CC1CCCO1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-12-24(22(26)15-19-8-4-3-5-9-19)18-23(27)25(16-20-10-6-13-28-20)17-21-11-7-14-29-21/h2-6,8-10,13,21H,1,7,11-12,14-18H2 |
| InChIKey | XKLYMHHDXVTYBQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|