C25H32N2O4 — CID 7225373
(2S)-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide (PubChem CID 7225373) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (2S)-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide.
| Compound Name | (2S)-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 7225373 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (2S)-N-[2-[furan-2-ylmethyl-[[(2R)-oxolan-2-yl]methyl]amino]-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccco1)C[C@H]1CCCO1)C(=O)[C@@H](CC)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O4/c1-3-14-26(25(29)23(4-2)20-10-6-5-7-11-20)19-24(28)27(17-21-12-8-15-30-21)18-22-13-9-16-31-22/h3,5-8,10-12,15,22-23H,1,4,9,13-14,16-19H2,2H3/t22-,23+/m1/s1 |
| InChIKey | FMPGTMGZYZFUSV-PKTZIBPZSA-N |
| XLogP | 4.00 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|