C17H23ClN2O4 — CID 93110158
2-[(2-chloroacetyl)-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 93110158) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[(2-chloroacetyl)-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 93110158 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[(2-chloroacetyl)-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccco1)C[C@@H]1CCCO1)C(=O)CCl |
| InChI | InChI=1S/C17H23ClN2O4/c1-2-7-19(16(21)10-18)13-17(22)20(11-14-5-3-8-23-14)12-15-6-4-9-24-15/h2-3,5,8,15H,1,4,6-7,9-13H2/t15-/m0/s1 |
| InChIKey | QJFBAMZSMALZID-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|