C27H31N3O4 — CID 3305402
2-[(2-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide (PubChem CID 3305402) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-[(2-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(2-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3305402 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-[(2-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(=O)Nc1ccccc1OCC |
| InChI | InChI=1S/C27H31N3O4/c1-3-17-30(27(32)28-24-14-8-9-15-25(24)33-4-2)21-26(31)29(20-23-13-10-19-34-23)18-16-22-11-6-5-7-12-22/h3,5-15,19H,1,4,16-18,20-21H2,2H3,(H,28,32) |
| InChIKey | QHNSXSACUIMAQW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|