C19H22N2O4 — CID 50967845
N-(2-ethoxyphenyl)-N'-(furan-2-ylmethyl)-N'-prop-2-enylpropanediamide (PubChem CID 50967845) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N'-(furan-2-ylmethyl)-N'-prop-2-enylpropanediamide.
| Compound Name | N-(2-ethoxyphenyl)-N'-(furan-2-ylmethyl)-N'-prop-2-enylpropanediamide |
|---|---|
| PubChem CID | 50967845 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-(2-ethoxyphenyl)-N'-(furan-2-ylmethyl)-N'-prop-2-enylpropanediamide |
| SMILES | C=CCN(Cc1ccco1)C(=O)CC(=O)Nc1ccccc1OCC |
| InChI | InChI=1S/C19H22N2O4/c1-3-11-21(14-15-8-7-12-25-15)19(23)13-18(22)20-16-9-5-6-10-17(16)24-4-2/h3,5-10,12H,1,4,11,13-14H2,2H3,(H,20,22) |
| InChIKey | IJXGEBLZSMDCNQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|