C17H22N2O5S — CID 113138557
N-(2-ethoxyphenyl)-3-[furan-2-ylmethyl(methylsulfonyl)amino]propanamide (PubChem CID 113138557) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-3-[furan-2-ylmethyl(methylsulfonyl)amino]propanamide.
| Compound Name | N-(2-ethoxyphenyl)-3-[furan-2-ylmethyl(methylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 113138557 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(2-ethoxyphenyl)-3-[furan-2-ylmethyl(methylsulfonyl)amino]propanamide |
| SMILES | CCOc1ccccc1NC(=O)CCN(Cc1ccco1)S(C)(=O)=O |
| InChI | InChI=1S/C17H22N2O5S/c1-3-23-16-9-5-4-8-15(16)18-17(20)10-11-19(25(2,21)22)13-14-7-6-12-24-14/h4-9,12H,3,10-11,13H2,1-2H3,(H,18,20) |
| InChIKey | FTUTYBPFSNFHAY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |