C16H20N2O5S — CID 113150359
N-(2-ethoxyphenyl)-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide (PubChem CID 113150359) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 113150359 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN(Cc1ccco1)S(C)(=O)=O |
| InChI | InChI=1S/C16H20N2O5S/c1-3-22-15-9-5-4-8-14(15)17-16(19)12-18(24(2,20)21)11-13-7-6-10-23-13/h4-10H,3,11-12H2,1-2H3,(H,17,19) |
| InChIKey | URGLDRIWMXBAIP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |