C13H20N2O4S — CID 113150243
N-cyclopentyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide (PubChem CID 113150243) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-cyclopentyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-cyclopentyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 113150243 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-cyclopentyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NC1CCCC1)Cc1ccco1 |
| InChI | InChI=1S/C13H20N2O4S/c1-20(17,18)15(9-12-7-4-8-19-12)10-13(16)14-11-5-2-3-6-11/h4,7-8,11H,2-3,5-6,9-10H2,1H3,(H,14,16) |
| InChIKey | CZSUFDYKDXKFIR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |