C12H20N2O4S — CID 113150306
N-tert-butyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide (PubChem CID 113150306) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-tert-butyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 113150306 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-tert-butyl-2-[furan-2-ylmethyl(methylsulfonyl)amino]acetamide |
| SMILES | CC(C)(C)NC(=O)CN(Cc1ccco1)S(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O4S/c1-12(2,3)13-11(15)9-14(19(4,16)17)8-10-6-5-7-18-10/h5-7H,8-9H2,1-4H3,(H,13,15) |
| InChIKey | IASVBUUAOUJYER-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |