C17H20N2O5 — CID 9438034
ethyl N-(furan-2-ylmethyl)-N-[2-(2-methoxyanilino)-2-oxoethyl]carbamate (PubChem CID 9438034) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl N-(furan-2-ylmethyl)-N-[2-(2-methoxyanilino)-2-oxoethyl]carbamate.
| Compound Name | ethyl N-(furan-2-ylmethyl)-N-[2-(2-methoxyanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 9438034 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl N-(furan-2-ylmethyl)-N-[2-(2-methoxyanilino)-2-oxoethyl]carbamate |
| SMILES | CCOC(=O)N(CC(=O)Nc1ccccc1OC)Cc1ccco1 |
| InChI | InChI=1S/C17H20N2O5/c1-3-23-17(21)19(11-13-7-6-10-24-13)12-16(20)18-14-8-4-5-9-15(14)22-2/h4-10H,3,11-12H2,1-2H3,(H,18,20) |
| InChIKey | WBWLBUIGXZKSKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |