C22H21FN2O5 — CID 8501196
2-[[2-(2-fluorophenoxy)acetyl]-(furan-2-ylmethyl)amino]-N-(2-methoxyphenyl)acetamide (PubChem CID 8501196) has the molecular formula C22H21FN2O5 and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenoxy)acetyl]-(furan-2-ylmethyl)amino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[[2-(2-fluorophenoxy)acetyl]-(furan-2-ylmethyl)amino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8501196 |
| Molecular Formula | C22H21FN2O5 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[[2-(2-fluorophenoxy)acetyl]-(furan-2-ylmethyl)amino]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN(Cc1ccco1)C(=O)COc1ccccc1F |
| InChI | InChI=1S/C22H21FN2O5/c1-28-20-11-5-3-9-18(20)24-21(26)14-25(13-16-7-6-12-29-16)22(27)15-30-19-10-4-2-8-17(19)23/h2-12H,13-15H2,1H3,(H,24,26) |
| InChIKey | BZFNETKZCINFJV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |