C23H24N2O3 — CID 42698044
1-(furan-2-ylmethyl)-3-(2-methoxyphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea (PubChem CID 42698044) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(2-methoxyphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(2-methoxyphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 42698044 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(2-methoxyphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea |
| SMILES | COc1ccccc1NC(=O)N(C/C(C)=C/c1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C23H24N2O3/c1-18(15-19-9-4-3-5-10-19)16-25(17-20-11-8-14-28-20)23(26)24-21-12-6-7-13-22(21)27-2/h3-15H,16-17H2,1-2H3,(H,24,26)/b18-15+ |
| InChIKey | MCDUTXFFANFRAN-OBGWFSINSA-N |
| XLogP | 5.43 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |