C23H23N3O5 — CID 9438050
N-[2-[furan-2-ylmethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide (PubChem CID 9438050) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[furan-2-ylmethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9438050 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[2-[furan-2-ylmethyl-[2-(2-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| SMILES | COc1ccccc1NC(=O)CN(Cc1ccco1)C(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O5/c1-30-20-12-6-5-11-19(20)25-21(27)16-26(15-18-10-7-13-31-18)22(28)14-24-23(29)17-8-3-2-4-9-17/h2-13H,14-16H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | BLDMSZRPIQZDGV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |