C23H26N2O7S — CID 4537719
[5-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 4537719) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is [5-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 4537719 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [5-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | CCOc1ccccc1NC(=O)N(Cc1ccc(OC)c(OS(C)(=O)=O)c1)Cc1ccco1 |
| InChI | InChI=1S/C23H26N2O7S/c1-4-30-20-10-6-5-9-19(20)24-23(26)25(16-18-8-7-13-31-18)15-17-11-12-21(29-2)22(14-17)32-33(3,27)28/h5-14H,4,15-16H2,1-3H3,(H,24,26) |
| InChIKey | XAKDNKKVEFWNTE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|