C21H19F3N2O5S — CID 4197444
[4-[[furan-2-ylmethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 4197444) has the molecular formula C21H19F3N2O5S and a molecular weight of 468.45 g/mol. Its IUPAC name is [4-[[furan-2-ylmethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[furan-2-ylmethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4197444 |
| Molecular Formula | C21H19F3N2O5S |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [4-[[furan-2-ylmethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(CN(Cc2ccco2)C(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N2O5S/c1-32(28,29)31-16-10-8-15(9-11-16)13-26(14-17-5-4-12-30-17)20(27)25-19-7-3-2-6-18(19)21(22,23)24/h2-12H,13-14H2,1H3,(H,25,27) |
| InChIKey | MPARSLSGXVUOTQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|