C20H16F4N2OS — CID 17371088
1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 17371088) has the molecular formula C20H16F4N2OS and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17371088 |
| Molecular Formula | C20H16F4N2OS |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | Fc1ccc(CN(Cc2ccco2)C(=S)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F4N2OS/c21-15-9-7-14(8-10-15)12-26(13-16-4-3-11-27-16)19(28)25-18-6-2-1-5-17(18)20(22,23)24/h1-11H,12-13H2,(H,25,28) |
| InChIKey | PSYSPIUPRQAYCM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|