C21H21FN2O3S — CID 1280841
3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)thiourea (PubChem CID 1280841) has the molecular formula C21H21FN2O3S and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1280841 |
| Molecular Formula | C21H21FN2O3S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2ccc(F)cc2)Cc2ccco2)cc1OC |
| InChI | InChI=1S/C21H21FN2O3S/c1-25-19-10-9-17(12-20(19)26-2)23-21(28)24(14-18-4-3-11-27-18)13-15-5-7-16(22)8-6-15/h3-12H,13-14H2,1-2H3,(H,23,28) |
| InChIKey | YCKLKCUWLPGOBT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|