C21H21BrN2OS — CID 4592206
3-(4-bromophenyl)-1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)thiourea (PubChem CID 4592206) has the molecular formula C21H21BrN2OS and a molecular weight of 429.38 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 3-(4-bromophenyl)-1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4592206 |
| Molecular Formula | C21H21BrN2OS |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 3-(4-bromophenyl)-1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCc1ccc(CN(Cc2ccco2)C(=S)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H21BrN2OS/c1-2-16-5-7-17(8-6-16)14-24(15-20-4-3-13-25-20)21(26)23-19-11-9-18(22)10-12-19/h3-13H,2,14-15H2,1H3,(H,23,26) |
| InChIKey | IZFBELWVPNWMNC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|